C29H32FN3O3S — CID 54784197
3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide (PubChem CID 54784197) has the molecular formula C29H32FN3O3S and a molecular weight of 521.66 g/mol. Its IUPAC name is 3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 54784197 |
| Molecular Formula | C29H32FN3O3S |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2cccc(C(=O)Nc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C29H32FN3O3S/c1-19-9-10-20(2)25(17-19)36-16-6-15-29(3,4)27(35)33-28(37)32-24-8-5-7-21(18-24)26(34)31-23-13-11-22(30)12-14-23/h5,7-14,17-18H,6,15-16H2,1-4H3,(H,31,34)(H2,32,33,35,37) |
| InChIKey | MDBLWDPUTLPKDC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|