C25H32N2O3S — CID 54784311
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-prop-2-enoxyphenyl)carbamothioyl]pentanamide (PubChem CID 54784311) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-prop-2-enoxyphenyl)carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-prop-2-enoxyphenyl)carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54784311 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-prop-2-enoxyphenyl)carbamothioyl]pentanamide |
| SMILES | C=CCOc1ccc(NC(=S)NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C25H32N2O3S/c1-6-15-29-21-12-10-20(11-13-21)26-24(31)27-23(28)25(4,5)14-7-16-30-22-17-18(2)8-9-19(22)3/h6,8-13,17H,1,7,14-16H2,2-5H3,(H2,26,27,28,31) |
| InChIKey | ZNDOSZRQQZWPDY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|