C33H41N3O3S — CID 54784256
4-tert-butyl-N-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]phenyl]benzamide (PubChem CID 54784256) has the molecular formula C33H41N3O3S and a molecular weight of 559.78 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 54784256 |
| Molecular Formula | C33H41N3O3S |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 4-tert-butyl-N-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]phenyl]benzamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(NC(=O)c3ccc(C(C)(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C33H41N3O3S/c1-22-9-10-23(2)28(21-22)39-20-8-19-33(6,7)30(38)36-31(40)35-27-17-15-26(16-18-27)34-29(37)24-11-13-25(14-12-24)32(3,4)5/h9-18,21H,8,19-20H2,1-7H3,(H,34,37)(H2,35,36,38,40) |
| InChIKey | ABYUIRBYMKKMEF-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|