C21H26FNO2 — CID 54788669
5-(2,5-dimethylphenoxy)-N-(3-fluorophenyl)-2,2-dimethylpentanamide (PubChem CID 54788669) has the molecular formula C21H26FNO2 and a molecular weight of 343.44 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-(3-fluorophenyl)-2,2-dimethylpentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-(3-fluorophenyl)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54788669 |
| Molecular Formula | C21H26FNO2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-(3-fluorophenyl)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H26FNO2/c1-15-9-10-16(2)19(13-15)25-12-6-11-21(3,4)20(24)23-18-8-5-7-17(22)14-18/h5,7-10,13-14H,6,11-12H2,1-4H3,(H,23,24) |
| InChIKey | UGCRDSOZLHBWGJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|