C26H34N2O3 — CID 54783726
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)phenyl]pentanamide (PubChem CID 54783726) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)phenyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 54783726 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[3-(pyrrolidine-1-carbonyl)phenyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2cccc(C(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C26H34N2O3/c1-19-11-12-20(2)23(17-19)31-16-8-13-26(3,4)25(30)27-22-10-7-9-21(18-22)24(29)28-14-5-6-15-28/h7,9-12,17-18H,5-6,8,13-16H2,1-4H3,(H,27,30) |
| InChIKey | HAAMDUWWLNFPBV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|