C26H34N2O4 — CID 54783853
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[4-(morpholine-4-carbonyl)phenyl]pentanamide (PubChem CID 54783853) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[4-(morpholine-4-carbonyl)phenyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[4-(morpholine-4-carbonyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 54783853 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[4-(morpholine-4-carbonyl)phenyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccc(C(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C26H34N2O4/c1-19-6-7-20(2)23(18-19)32-15-5-12-26(3,4)25(30)27-22-10-8-21(9-11-22)24(29)28-13-16-31-17-14-28/h6-11,18H,5,12-17H2,1-4H3,(H,27,30) |
| InChIKey | JZLLAEJMVBUKBR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|