C19H29NO3 — CID 54783497
5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-morpholin-4-ylpentan-1-one (PubChem CID 54783497) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-morpholin-4-ylpentan-1-one.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 54783497 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-morpholin-4-ylpentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H29NO3/c1-15-6-7-16(2)17(14-15)23-11-5-8-19(3,4)18(21)20-9-12-22-13-10-20/h6-7,14H,5,8-13H2,1-4H3 |
| InChIKey | GQUFOVOIDAMTKW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|