C26H33F3N2O4S — CID 175467274
5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 175467274) has the molecular formula C26H33F3N2O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 175467274 |
| Molecular Formula | C26H33F3N2O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)N2CCN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H33F3N2O4S/c1-19-6-7-20(2)23(18-19)35-17-5-12-25(3,4)24(32)30-13-15-31(16-14-30)36(33,34)22-10-8-21(9-11-22)26(27,28)29/h6-11,18H,5,12-17H2,1-4H3 |
| InChIKey | AGXVTPBWYHFWCF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|