C27H38N4O4S2 — CID 54783987
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]pentanamide (PubChem CID 54783987) has the molecular formula C27H38N4O4S2 and a molecular weight of 546.76 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54783987 |
| Molecular Formula | C27H38N4O4S2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C27H38N4O4S2/c1-20-7-8-21(2)24(19-20)35-18-6-13-27(3,4)25(32)29-26(36)28-22-9-11-23(12-10-22)37(33,34)31-16-14-30(5)15-17-31/h7-12,19H,6,13-18H2,1-5H3,(H2,28,29,32,36) |
| InChIKey | QHXJZSGPJYMOOX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|