C26H32N4O5S2 — CID 54784030
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pentanamide (PubChem CID 54784030) has the molecular formula C26H32N4O5S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54784030 |
| Molecular Formula | C26H32N4O5S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3cc(C)on3)cc2)c1 |
| InChI | InChI=1S/C26H32N4O5S2/c1-17-7-8-18(2)22(15-17)34-14-6-13-26(4,5)24(31)28-25(36)27-20-9-11-21(12-10-20)37(32,33)30-23-16-19(3)35-29-23/h7-12,15-16H,6,13-14H2,1-5H3,(H,29,30)(H2,27,28,31,36) |
| InChIKey | XFMVTADTPHGEJS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|