C30H37N3O4S2 — CID 54784163
N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 54784163) has the molecular formula C30H37N3O4S2 and a molecular weight of 567.78 g/mol. Its IUPAC name is N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54784163 |
| Molecular Formula | C30H37N3O4S2 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H37N3O4S2/c1-22-12-13-23(2)27(20-22)37-19-9-18-30(3,4)28(34)32-29(38)31-25-14-16-26(17-15-25)39(35,36)33(5)21-24-10-7-6-8-11-24/h6-8,10-17,20H,9,18-19,21H2,1-5H3,(H2,31,32,34,38) |
| InChIKey | MOKBIEILXKGLBO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|