C20H25N3O3S2 — CID 1259482
N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 1259482) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 1259482 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=S)NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O3S2/c1-20(2,3)18(24)22-19(27)21-16-10-12-17(13-11-16)28(25,26)23(4)14-15-8-6-5-7-9-15/h5-13H,14H2,1-4H3,(H2,21,22,24,27) |
| InChIKey | GATGGNBZVUAEFK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|