C30H29N3O4S2 — CID 4956802
N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 4956802) has the molecular formula C30H29N3O4S2 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 4956802 |
| Molecular Formula | C30H29N3O4S2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | N-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H29N3O4S2/c1-33(22-24-10-6-3-7-11-24)39(35,36)28-18-14-26(15-19-28)31-30(38)32-29(34)25-12-16-27(17-13-25)37-21-20-23-8-4-2-5-9-23/h2-19H,20-22H2,1H3,(H2,31,32,34,38) |
| InChIKey | JBLREVRALFNCHZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|