C25H26N2O5S — CID 17067082
3,4,5-trimethoxy-N-[[4-(2-phenylethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17067082) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-(2-phenylethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-(2-phenylethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17067082 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-(2-phenylethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(OCCc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N2O5S/c1-29-21-15-18(16-22(30-2)23(21)31-3)24(28)27-25(33)26-19-9-11-20(12-10-19)32-14-13-17-7-5-4-6-8-17/h4-12,15-16H,13-14H2,1-3H3,(H2,26,27,28,33) |
| InChIKey | GQQQUKLBRQFXOZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|