C25H24N2O4S — CID 17175711
methyl 3-[[4-(3-phenylpropoxy)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17175711) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is methyl 3-[[4-(3-phenylpropoxy)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[4-(3-phenylpropoxy)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17175711 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | methyl 3-[[4-(3-phenylpropoxy)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)Nc2ccc(OCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H24N2O4S/c1-30-24(29)20-11-5-10-19(17-20)23(28)27-25(32)26-21-12-14-22(15-13-21)31-16-6-9-18-7-3-2-4-8-18/h2-5,7-8,10-15,17H,6,9,16H2,1H3,(H2,26,27,28,32) |
| InChIKey | KABHDXIWKQMJCB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|