C20H24N2O5S — CID 4943199
3,4,5-trimethoxy-N-[(4-propoxyphenyl)carbamothioyl]benzamide (PubChem CID 4943199) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(4-propoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(4-propoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4943199 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(4-propoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCCOc1ccc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-5-10-27-15-8-6-14(7-9-15)21-20(28)22-19(23)13-11-16(24-2)18(26-4)17(12-13)25-3/h6-9,11-12H,5,10H2,1-4H3,(H2,21,22,23,28) |
| InChIKey | MUOMTBHKQYPAJC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|