C22H26N2O6S — CID 4958021
3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 4958021) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4958021 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(OCC3CCCO3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O6S/c1-26-18-11-14(12-19(27-2)20(18)28-3)21(25)24-22(31)23-15-6-8-16(9-7-15)30-13-17-5-4-10-29-17/h6-9,11-12,17H,4-5,10,13H2,1-3H3,(H2,23,24,25,31) |
| InChIKey | MQHFZFZEIDZNDS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|