C21H24N2O4S — CID 8544151
2-ethoxy-N-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]carbamothioyl]benzamide (PubChem CID 8544151) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-ethoxy-N-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-ethoxy-N-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 8544151 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-ethoxy-N-[[4-[[(2R)-oxolan-2-yl]methoxy]phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NC(=S)Nc1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-2-25-19-8-4-3-7-18(19)20(24)23-21(28)22-15-9-11-16(12-10-15)27-14-17-6-5-13-26-17/h3-4,7-12,17H,2,5-6,13-14H2,1H3,(H2,22,23,24,28)/t17-/m1/s1 |
| InChIKey | GCPBQEJSMCHHEB-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|