C19H19ClN2O3S — CID 4958006
4-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 4958006) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 4-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4958006 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 4-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCC2CCCO2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O3S/c20-14-5-3-13(4-6-14)18(23)22-19(26)21-15-7-9-16(10-8-15)25-12-17-2-1-11-24-17/h3-10,17H,1-2,11-12H2,(H2,21,22,23,26) |
| InChIKey | OXHOAQVSWLCXFZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|