C19H18N4O7S — CID 4958009
3,5-dinitro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 4958009) has the molecular formula C19H18N4O7S and a molecular weight of 446.44 g/mol. Its IUPAC name is 3,5-dinitro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dinitro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4958009 |
| Molecular Formula | C19H18N4O7S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 3,5-dinitro-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCC2CCCO2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N4O7S/c24-18(12-8-14(22(25)26)10-15(9-12)23(27)28)21-19(31)20-13-3-5-16(6-4-13)30-11-17-2-1-7-29-17/h3-6,8-10,17H,1-2,7,11H2,(H2,20,21,24,31) |
| InChIKey | PWELRHJAHUDJEV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|