C13H14N4O6S — CID 4630225
3,5-dinitro-N-(oxolan-2-ylmethylcarbamothioyl)benzamide (PubChem CID 4630225) has the molecular formula C13H14N4O6S and a molecular weight of 354.34 g/mol. Its IUPAC name is 3,5-dinitro-N-(oxolan-2-ylmethylcarbamothioyl)benzamide.
| Compound Name | 3,5-dinitro-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4630225 |
| Molecular Formula | C13H14N4O6S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3,5-dinitro-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)NCC1CCCO1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N4O6S/c18-12(15-13(24)14-7-11-2-1-3-23-11)8-4-9(16(19)20)6-10(5-8)17(21)22/h4-6,11H,1-3,7H2,(H2,14,15,18,24) |
| InChIKey | FNQBNQWDKVFULK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|