C12H14N3O4S- — CID 8684649
4-nitro-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]phenolate (PubChem CID 8684649) has the molecular formula C12H14N3O4S- and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-nitro-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]phenolate.
| Compound Name | 4-nitro-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]phenolate |
|---|---|
| PubChem CID | 8684649 |
| Molecular Formula | C12H14N3O4S- |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-nitro-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]phenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(NC(=S)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C12H15N3O4S/c16-11-4-3-8(15(17)18)6-10(11)14-12(20)13-7-9-2-1-5-19-9/h3-4,6,9,16H,1-2,5,7H2,(H2,13,14,20)/p-1/t9-/m0/s1 |
| InChIKey | XYTONOMDLASLJV-VIFPVBQESA-M |
| XLogP | 1.13 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|