C13H15F2N3O5 — CID 94156226
1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 94156226) has the molecular formula C13H15F2N3O5 and a molecular weight of 331.28 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 94156226 |
| Molecular Formula | C13H15F2N3O5 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCCO1)Nc1cc([N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C13H15F2N3O5/c14-12(15)23-11-4-3-8(18(20)21)6-10(11)17-13(19)16-7-9-2-1-5-22-9/h3-4,6,9,12H,1-2,5,7H2,(H2,16,17,19)/t9-/m1/s1 |
| InChIKey | IQKHZKURFNIBLZ-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|