C23H27N5O5 — CID 55524469
5-nitro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 55524469) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is 5-nitro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-nitro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55524469 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 5-nitro-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C23H27N5O5/c29-22(20-14-18(28(31)32)9-10-21(20)27-11-1-2-12-27)25-16-5-7-17(8-6-16)26-23(30)24-15-19-4-3-13-33-19/h5-10,14,19H,1-4,11-13,15H2,(H,25,29)(H2,24,26,30) |
| InChIKey | GRRXLEJVXKXYFX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|