C13H15N3O5 — CID 7323851
N'-(4-nitrophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 7323851) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is N'-(4-nitrophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-(4-nitrophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7323851 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N'-(4-nitrophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15N3O5/c17-12(14-8-11-2-1-7-21-11)13(18)15-9-3-5-10(6-4-9)16(19)20/h3-6,11H,1-2,7-8H2,(H,14,17)(H,15,18)/t11-/m0/s1 |
| InChIKey | ZGWVXVSSOFVVGO-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|