C12H15N3O3 — CID 41453086
N-[[(2R)-oxolan-2-yl]methyl]-N'-pyridin-4-yloxamide (PubChem CID 41453086) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-N'-pyridin-4-yloxamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-N'-pyridin-4-yloxamide |
|---|---|
| PubChem CID | 41453086 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-N'-pyridin-4-yloxamide |
| SMILES | O=C(NC[C@H]1CCCO1)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C12H15N3O3/c16-11(14-8-10-2-1-7-18-10)12(17)15-9-3-5-13-6-4-9/h3-6,10H,1-2,7-8H2,(H,14,16)(H,13,15,17)/t10-/m1/s1 |
| InChIKey | NNOFOOPYKISCHT-SNVBAGLBSA-N |
| XLogP | 0.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|