C13H15BrN2O3 — CID 2274084
N'-(3-bromophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 2274084) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is N'-(3-bromophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-(3-bromophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 2274084 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N'-(3-bromophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O3/c14-9-3-1-4-10(7-9)16-13(18)12(17)15-8-11-5-2-6-19-11/h1,3-4,7,11H,2,5-6,8H2,(H,15,17)(H,16,18)/t11-/m0/s1 |
| InChIKey | LESZKBSUIHYVLR-NSHDSACASA-N |
| XLogP | 1.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|