C15H19N3O4 — CID 7379139
N'-(4-acetamidophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 7379139) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is N'-(4-acetamidophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-(4-acetamidophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7379139 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N'-(4-acetamidophenyl)-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C15H19N3O4/c1-10(19)17-11-4-6-12(7-5-11)18-15(21)14(20)16-9-13-3-2-8-22-13/h4-7,13H,2-3,8-9H2,1H3,(H,16,20)(H,17,19)(H,18,21)/t13-/m0/s1 |
| InChIKey | OXTFPCHGWNZKBX-ZDUSSCGKSA-N |
| XLogP | 0.88 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|