C13H16N2O3 — CID 3114289
N-(oxolan-2-ylmethyl)-N'-phenyloxamide (PubChem CID 3114289) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N'-phenyloxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 3114289 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N'-phenyloxamide |
| SMILES | O=C(NCC1CCCO1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(14-9-11-7-4-8-18-11)13(17)15-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,14,16)(H,15,17) |
| InChIKey | PTWOEOKHIDAMED-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|