C14H18N2O3 — CID 21211581
N'-benzyl-N-(oxolan-2-ylmethyl)oxamide (PubChem CID 21211581) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N'-benzyl-N-(oxolan-2-ylmethyl)oxamide.
| Compound Name | N'-benzyl-N-(oxolan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 21211581 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N'-benzyl-N-(oxolan-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C14H18N2O3/c17-13(15-9-11-5-2-1-3-6-11)14(18)16-10-12-7-4-8-19-12/h1-3,5-6,12H,4,7-10H2,(H,15,17)(H,16,18) |
| InChIKey | CBKIMWFLAAOWRK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|