C14H18N2O3S — CID 2955391
4-[(oxolan-2-ylmethylcarbamothioylamino)methyl]benzoic acid (PubChem CID 2955391) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-[(oxolan-2-ylmethylcarbamothioylamino)methyl]benzoic acid.
| Compound Name | 4-[(oxolan-2-ylmethylcarbamothioylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 2955391 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[(oxolan-2-ylmethylcarbamothioylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c17-13(18)11-5-3-10(4-6-11)8-15-14(20)16-9-12-2-1-7-19-12/h3-6,12H,1-2,7-9H2,(H,17,18)(H2,15,16,20) |
| InChIKey | XKIXTKRVPJSOFY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|