C15H21N3O3 — CID 7585533
N'-[4-(dimethylamino)phenyl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 7585533) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N'-[4-(dimethylamino)phenyl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[4-(dimethylamino)phenyl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7585533 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N'-[4-(dimethylamino)phenyl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | CN(C)c1ccc(NC(=O)C(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-18(2)12-7-5-11(6-8-12)17-15(20)14(19)16-10-13-4-3-9-21-13/h5-8,13H,3-4,9-10H2,1-2H3,(H,16,19)(H,17,20)/t13-/m0/s1 |
| InChIKey | GDRZLQZKNXIOFU-ZDUSSCGKSA-N |
| XLogP | 0.99 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|