C14H20N2OS — CID 2983117
4-(dimethylamino)-N-(oxolan-2-ylmethyl)benzenecarbothioamide (PubChem CID 2983117) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(oxolan-2-ylmethyl)benzenecarbothioamide.
| Compound Name | 4-(dimethylamino)-N-(oxolan-2-ylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 2983117 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-(dimethylamino)-N-(oxolan-2-ylmethyl)benzenecarbothioamide |
| SMILES | CN(C)c1ccc(C(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H20N2OS/c1-16(2)12-7-5-11(6-8-12)14(18)15-10-13-4-3-9-17-13/h5-8,13H,3-4,9-10H2,1-2H3,(H,15,18) |
| InChIKey | UVDAYZTWXVXFIS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|