C23H27N3O3 — CID 6248371
N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide (PubChem CID 6248371) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6248371 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-26(2)19-12-10-17(11-13-19)15-21(23(28)24-16-20-9-6-14-29-20)25-22(27)18-7-4-3-5-8-18/h3-5,7-8,10-13,15,20H,6,9,14,16H2,1-2H3,(H,24,28)(H,25,27)/b21-15+ |
| InChIKey | OAJDWHCGYIRDMW-RCCKNPSSSA-N |
| XLogP | 2.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|