C31H34N2O7 — CID 5349611
4-methoxy-N-[(E)-1-[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide (PubChem CID 5349611) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is 4-methoxy-N-[(E)-1-[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[(E)-1-[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5349611 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 4-methoxy-N-[(E)-1-[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)N/C(=C/c2ccc(OCCOc3ccccc3OC)cc2)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C31H34N2O7/c1-36-24-15-11-23(12-16-24)30(34)33-27(31(35)32-21-26-6-5-17-38-26)20-22-9-13-25(14-10-22)39-18-19-40-29-8-4-3-7-28(29)37-2/h3-4,7-16,20,26H,5-6,17-19,21H2,1-2H3,(H,32,35)(H,33,34)/b27-20+ |
| InChIKey | HKHNYNOXBMDPAL-NHFJDJAPSA-N |
| XLogP | 4.23 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|