C34H33FN2O6 — CID 3517405
N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3517405) has the molecular formula C34H33FN2O6 and a molecular weight of 584.64 g/mol. Its IUPAC name is N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3517405 |
| Molecular Formula | C34H33FN2O6 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | N-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(CCNC(=O)C(=Cc2ccc(OCCOc3ccccc3F)cc2)NC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C34H33FN2O6/c1-40-31-17-14-25(23-32(31)41-2)18-19-36-34(39)29(37-33(38)26-8-4-3-5-9-26)22-24-12-15-27(16-13-24)42-20-21-43-30-11-7-6-10-28(30)35/h3-17,22-23H,18-21H2,1-2H3,(H,36,39)(H,37,38) |
| InChIKey | KJZDBLXJXPNYSX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|