C27H27ClN2O5 — CID 66812259
N-[1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-[2-(4-methoxyphenyl)ethoxy]benzamide (PubChem CID 66812259) has the molecular formula C27H27ClN2O5 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-[2-(4-methoxyphenyl)ethoxy]benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-[2-(4-methoxyphenyl)ethoxy]benzamide |
|---|---|
| PubChem CID | 66812259 |
| Molecular Formula | C27H27ClN2O5 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-[2-(4-methoxyphenyl)ethoxy]benzamide |
| SMILES | COc1ccc(CCOc2ccc(C(=O)NC(=Cc3ccc(Cl)cc3)C(=O)NCCO)cc2)cc1 |
| InChI | InChI=1S/C27H27ClN2O5/c1-34-23-10-4-19(5-11-23)14-17-35-24-12-6-21(7-13-24)26(32)30-25(27(33)29-15-16-31)18-20-2-8-22(28)9-3-20/h2-13,18,31H,14-17H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | RHXAEJPXNPOTCT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|