C32H34N2O6 — CID 77171306
2-[[3-(4-cyclopropylphenyl)-2-[[4-[2-(4-methoxyphenyl)ethoxy]benzoyl]amino]prop-2-enoyl]amino]ethyl acetate (PubChem CID 77171306) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is 2-[[3-(4-cyclopropylphenyl)-2-[[4-[2-(4-methoxyphenyl)ethoxy]benzoyl]amino]prop-2-enoyl]amino]ethyl acetate.
| Compound Name | 2-[[3-(4-cyclopropylphenyl)-2-[[4-[2-(4-methoxyphenyl)ethoxy]benzoyl]amino]prop-2-enoyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 77171306 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-[[3-(4-cyclopropylphenyl)-2-[[4-[2-(4-methoxyphenyl)ethoxy]benzoyl]amino]prop-2-enoyl]amino]ethyl acetate |
| SMILES | COc1ccc(CCOc2ccc(C(=O)NC(=Cc3ccc(C4CC4)cc3)C(=O)NCCOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O6/c1-22(35)39-20-18-33-32(37)30(21-24-3-7-25(8-4-24)26-9-10-26)34-31(36)27-11-15-29(16-12-27)40-19-17-23-5-13-28(38-2)14-6-23/h3-8,11-16,21,26H,9-10,17-20H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | DHKVJNIFWPBSCX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|