C29H30N2O5 — CID 66812193
N-[1-(4-cyclopropyloxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-phenylethoxy)benzamide (PubChem CID 66812193) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[1-(4-cyclopropyloxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[1-(4-cyclopropyloxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 66812193 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N-[1-(4-cyclopropyloxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NCCO)C(=Cc1ccc(OC2CC2)cc1)NC(=O)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O5/c32-18-17-30-29(34)27(20-22-6-10-25(11-7-22)36-26-14-15-26)31-28(33)23-8-12-24(13-9-23)35-19-16-21-4-2-1-3-5-21/h1-13,20,26,32H,14-19H2,(H,30,34)(H,31,33) |
| InChIKey | GVIOUSTUFVJORS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|