C31H36N2O5 — CID 66812684
N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-(4-phenylbutoxy)benzamide (PubChem CID 66812684) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-(4-phenylbutoxy)benzamide.
| Compound Name | N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-(4-phenylbutoxy)benzamide |
|---|---|
| PubChem CID | 66812684 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]-4-(4-phenylbutoxy)benzamide |
| SMILES | CC(C)Oc1ccc(C=C(NC(=O)c2ccc(OCCCCc3ccccc3)cc2)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C31H36N2O5/c1-23(2)38-28-15-11-25(12-16-28)22-29(31(36)32-19-20-34)33-30(35)26-13-17-27(18-14-26)37-21-7-6-10-24-8-4-3-5-9-24/h3-5,8-9,11-18,22-23,34H,6-7,10,19-21H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | VSGOXQXVIKPZIV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|