C23H26F2N2O5 — CID 66812067
N-[(E)-1-[4-(difluoromethoxy)phenyl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-methylpropoxy)benzamide (PubChem CID 66812067) has the molecular formula C23H26F2N2O5 and a molecular weight of 448.47 g/mol. Its IUPAC name is N-[(E)-1-[4-(difluoromethoxy)phenyl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[(E)-1-[4-(difluoromethoxy)phenyl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 66812067 |
| Molecular Formula | C23H26F2N2O5 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[(E)-1-[4-(difluoromethoxy)phenyl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)N/C(=C/c2ccc(OC(F)F)cc2)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C23H26F2N2O5/c1-15(2)14-31-18-9-5-17(6-10-18)21(29)27-20(22(30)26-11-12-28)13-16-3-7-19(8-4-16)32-23(24)25/h3-10,13,15,23,28H,11-12,14H2,1-2H3,(H,26,30)(H,27,29)/b20-13+ |
| InChIKey | APVWQIWBLIQNIC-DEDYPNTBSA-N |
| XLogP | 3.20 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|