C28H34N2O5 — CID 66812180
4-(2-cyclopent-2-en-1-ylethoxy)-N-[(E)-3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 66812180) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-(2-cyclopent-2-en-1-ylethoxy)-N-[(E)-3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | 4-(2-cyclopent-2-en-1-ylethoxy)-N-[(E)-3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 66812180 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 4-(2-cyclopent-2-en-1-ylethoxy)-N-[(E)-3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(C)Oc1ccc(/C=C(/NC(=O)c2ccc(OCCC3C=CCC3)cc2)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C28H34N2O5/c1-20(2)35-25-11-7-22(8-12-25)19-26(28(33)29-16-17-31)30-27(32)23-9-13-24(14-10-23)34-18-15-21-5-3-4-6-21/h3,5,7-14,19-21,31H,4,6,15-18H2,1-2H3,(H,29,33)(H,30,32)/b26-19+ |
| InChIKey | RIIHPAJXIOCADG-LGUFXXKBSA-N |
| XLogP | 4.09 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|