C26H24Cl2N2O4 — CID 11978645
4-[2-(4-chlorophenyl)ethoxy]-N-[(E)-1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 11978645) has the molecular formula C26H24Cl2N2O4 and a molecular weight of 499.39 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethoxy]-N-[(E)-1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-[2-(4-chlorophenyl)ethoxy]-N-[(E)-1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 11978645 |
| Molecular Formula | C26H24Cl2N2O4 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethoxy]-N-[(E)-1-(4-chlorophenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCO)/C(=C\c1ccc(Cl)cc1)NC(=O)c1ccc(OCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O4/c27-21-7-1-18(2-8-21)13-16-34-23-11-5-20(6-12-23)25(32)30-24(26(33)29-14-15-31)17-19-3-9-22(28)10-4-19/h1-12,17,31H,13-16H2,(H,29,33)(H,30,32)/b24-17+ |
| InChIKey | SJLKWBSPPQXETG-JJIBRWJFSA-N |
| XLogP | 4.49 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|