C28H36N2O5 — CID 66812008
4-(4-cyclopropylbutoxy)-N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 66812008) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-(4-cyclopropylbutoxy)-N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | 4-(4-cyclopropylbutoxy)-N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 66812008 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 4-(4-cyclopropylbutoxy)-N-[3-(2-hydroxyethylamino)-3-oxo-1-(4-propan-2-yloxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(C)Oc1ccc(C=C(NC(=O)c2ccc(OCCCCC3CC3)cc2)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C28H36N2O5/c1-20(2)35-25-12-8-22(9-13-25)19-26(28(33)29-16-17-31)30-27(32)23-10-14-24(15-11-23)34-18-4-3-5-21-6-7-21/h8-15,19-21,31H,3-7,16-18H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | LAXKBGHTBPXZRG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|