C31H30N4O4 — CID 41042761
N-[(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 41042761) has the molecular formula C31H30N4O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 41042761 |
| Molecular Formula | C31H30N4O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C\c2cn(-c3ccccc3)nc2-c2ccccc2)C(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C31H30N4O4/c1-38-26-16-14-23(15-17-26)30(36)33-28(31(37)32-20-27-13-8-18-39-27)19-24-21-35(25-11-6-3-7-12-25)34-29(24)22-9-4-2-5-10-22/h2-7,9-12,14-17,19,21,27H,8,13,18,20H2,1H3,(H,32,37)(H,33,36)/b28-19-/t27-/m0/s1 |
| InChIKey | KGDJCLIXFPGXAN-QWJUGSESSA-N |
| XLogP | 4.61 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|