C29H27N5O3 — CID 4054794
N-[3-oxo-3-(oxolan-2-ylmethylamino)-1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide (PubChem CID 4054794) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is N-[3-oxo-3-(oxolan-2-ylmethylamino)-1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[3-oxo-3-(oxolan-2-ylmethylamino)-1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4054794 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-[3-oxo-3-(oxolan-2-ylmethylamino)-1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCC1CCCO1)C(=Cc1cn(-c2ccccc2)nc1-c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27N5O3/c35-28(21-9-3-1-4-10-21)32-26(29(36)31-19-25-14-8-16-37-25)17-23-20-34(24-12-5-2-6-13-24)33-27(23)22-11-7-15-30-18-22/h1-7,9-13,15,17-18,20,25H,8,14,16,19H2,(H,31,36)(H,32,35) |
| InChIKey | LFVBEESYUQKFPM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|