C31H24N6O4 — CID 1420861
N-[1-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide (PubChem CID 1420861) has the molecular formula C31H24N6O4 and a molecular weight of 544.57 g/mol. Its IUPAC name is N-[1-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[1-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 1420861 |
| Molecular Formula | C31H24N6O4 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-[1-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1cccnc1)C(=Cc1cn(-c2ccccc2)nc1-c1cccc([N+](=O)[O-])c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H24N6O4/c38-30(23-10-3-1-4-11-23)34-28(31(39)33-20-22-9-8-16-32-19-22)18-25-21-36(26-13-5-2-6-14-26)35-29(25)24-12-7-15-27(17-24)37(40)41/h1-19,21H,20H2,(H,33,39)(H,34,38) |
| InChIKey | RTYQXQJTXUZDIP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|