C28H23N3O5 — CID 2131805
N-[(Z)-3-[(4-methylphenyl)methylamino]-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2131805) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is N-[(Z)-3-[(4-methylphenyl)methylamino]-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(4-methylphenyl)methylamino]-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2131805 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[(Z)-3-[(4-methylphenyl)methylamino]-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(CNC(=O)/C(=C/c2ccc(-c3cccc([N+](=O)[O-])c3)o2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N3O5/c1-19-10-12-20(13-11-19)18-29-28(33)25(30-27(32)21-6-3-2-4-7-21)17-24-14-15-26(36-24)22-8-5-9-23(16-22)31(34)35/h2-17H,18H2,1H3,(H,29,33)(H,30,32)/b25-17- |
| InChIKey | HQRRUNVEOSXHBE-UQQQWYQISA-N |
| XLogP | 5.25 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|