C27H23N3O3 — CID 124657322
N-[(Z)-3-[(2-aminophenyl)methylamino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide (PubChem CID 124657322) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[(Z)-3-[(2-aminophenyl)methylamino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2-aminophenyl)methylamino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 124657322 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[(Z)-3-[(2-aminophenyl)methylamino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
| SMILES | Nc1ccccc1CNC(=O)/C(=C/c1ccc(-c2ccccc2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O3/c28-23-14-8-7-13-21(23)18-29-27(32)24(30-26(31)20-11-5-2-6-12-20)17-22-15-16-25(33-22)19-9-3-1-4-10-19/h1-17H,18,28H2,(H,29,32)(H,30,31)/b24-17- |
| InChIKey | FSUAGWGTWJLXFS-ULJHMMPZSA-N |
| XLogP | 4.62 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|