C22H19BrN2O4 — CID 34318326
N-[(Z)-1-[5-(4-bromophenyl)furan-2-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 34318326) has the molecular formula C22H19BrN2O4 and a molecular weight of 455.31 g/mol. Its IUPAC name is N-[(Z)-1-[5-(4-bromophenyl)furan-2-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[5-(4-bromophenyl)furan-2-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 34318326 |
| Molecular Formula | C22H19BrN2O4 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | N-[(Z)-1-[5-(4-bromophenyl)furan-2-yl]-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCO)/C(=C/c1ccc(-c2ccc(Br)cc2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19BrN2O4/c23-17-8-6-15(7-9-17)20-11-10-18(29-20)14-19(22(28)24-12-13-26)25-21(27)16-4-2-1-3-5-16/h1-11,14,26H,12-13H2,(H,24,28)(H,25,27)/b19-14- |
| InChIKey | YWTSPZWTJMVDBH-RGEXLXHISA-N |
| XLogP | 3.59 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|